C15H14N4O — CID 61103321
3,5-diamino-N-[(3-cyanophenyl)methyl]benzamide (PubChem CID 61103321) has the molecular formula C15H14N4O and a molecular weight of 266.30 g/mol. Its IUPAC name is 3,5-diamino-N-[(3-cyanophenyl)methyl]benzamide.
| Compound Name | 3,5-diamino-N-[(3-cyanophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 61103321 |
| Molecular Formula | C15H14N4O |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 3,5-diamino-N-[(3-cyanophenyl)methyl]benzamide |
| SMILES | N#Cc1cccc(CNC(=O)c2cc(N)cc(N)c2)c1 |
| InChI | InChI=1S/C15H14N4O/c16-8-10-2-1-3-11(4-10)9-19-15(20)12-5-13(17)7-14(18)6-12/h1-7H,9,17-18H2,(H,19,20) |
| InChIKey | UMFAIYHQSOZZRH-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 104.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|