C15H18N4O2 — CID 61103566
3,5-diamino-N-(6-oxo-1-propyl-3-pyridinyl)benzamide (PubChem CID 61103566) has the molecular formula C15H18N4O2 and a molecular weight of 286.34 g/mol. Its IUPAC name is 3,5-diamino-N-(6-oxo-1-propyl-3-pyridinyl)benzamide.
| Compound Name | 3,5-diamino-N-(6-oxo-1-propyl-3-pyridinyl)benzamide |
|---|---|
| PubChem CID | 61103566 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 3,5-diamino-N-(6-oxo-1-propyl-3-pyridinyl)benzamide |
| SMILES | CCCn1cc(NC(=O)c2cc(N)cc(N)c2)ccc1=O |
| InChI | InChI=1S/C15H18N4O2/c1-2-5-19-9-13(3-4-14(19)20)18-15(21)10-6-11(16)8-12(17)7-10/h3-4,6-9H,2,5,16-17H2,1H3,(H,18,21) |
| InChIKey | QJLCKMNUOPRWOK-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 103.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|