C14H17ClN2S — CID 61104342
N-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-N-ethyl-3-methylaniline (PubChem CID 61104342) has the molecular formula C14H17ClN2S and a molecular weight of 280.82 g/mol. Its IUPAC name is N-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-N-ethyl-3-methylaniline.
| Compound Name | N-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-N-ethyl-3-methylaniline |
|---|---|
| PubChem CID | 61104342 |
| Molecular Formula | C14H17ClN2S |
| Molecular Weight | 280.82 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | N-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-N-ethyl-3-methylaniline |
| SMILES | CCN(Cc1nc(CCl)cs1)c1cccc(C)c1 |
| InChI | InChI=1S/C14H17ClN2S/c1-3-17(13-6-4-5-11(2)7-13)9-14-16-12(8-15)10-18-14/h4-7,10H,3,8-9H2,1-2H3 |
| InChIKey | QEOMPJABXKQIIZ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.82 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|