C11H13Br2F3N2O2S — CID 61106057
4-amino-2,6-dibromo-N-propyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide (PubChem CID 61106057) has the molecular formula C11H13Br2F3N2O2S and a molecular weight of 454.11 g/mol. Its IUPAC name is 4-amino-2,6-dibromo-N-propyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide.
| Compound Name | 4-amino-2,6-dibromo-N-propyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 61106057 |
| Molecular Formula | C11H13Br2F3N2O2S |
| Molecular Weight | 454.11 g/mol |
| Exact Mass | 451.90 |
| IUPAC Name | 4-amino-2,6-dibromo-N-propyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
| SMILES | CCCN(CC(F)(F)F)S(=O)(=O)c1c(Br)cc(N)cc1Br |
| InChI | InChI=1S/C11H13Br2F3N2O2S/c1-2-3-18(6-11(14,15)16)21(19,20)10-8(12)4-7(17)5-9(10)13/h4-5H,2-3,6,17H2,1H3 |
| InChIKey | OWWPTFHRVLUGQZ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.11 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|