About 2-chloroethoxymethyl-[4-(dimethylamino)-6-methylsulfanyl-1,3,5-triazin-2-yl]cyanamide
2-chloroethoxymethyl-[4-(dimethylamino)-6-methylsulfanyl-1,3,5-triazin-2-yl]cyanamide (PubChem CID 611073) has the molecular formula C10H15ClN6OS
and a molecular weight of 302.79 g/mol. Its IUPAC name is 2-chloroethoxymethyl-[4-(dimethylamino)-6-methylsulfanyl-1,3,5-triazin-2-yl]cyanamide.
Molecular Properties
| Compound Name | 2-chloroethoxymethyl-[4-(dimethylamino)-6-methylsulfanyl-1,3,5-triazin-2-yl]cyanamide |
| PubChem CID | 611073 |
| Molecular Formula | C10H15ClN6OS |
| Molecular Weight | 302.79 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 2-chloroethoxymethyl-[4-(dimethylamino)-6-methylsulfanyl-1,3,5-triazin-2-yl]cyanamide |
| SMILES | CSc1nc(N(C)C)nc(N(C#N)COCCCl)n1 |
| InChI | InChI=1S/C10H15ClN6OS/c1-16(2)8-13-9(15-10(14-8)19-3)17(6-12)7-18-5-4-11/h4-5,7H2,1-3H3 |
| InChIKey | LRRCPWAJAMDTRW-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 78.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.79 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-chloroethoxymethyl-[4-(dimethylamino)-6-methylsulfanyl-1,3,5-triazin-2-yl]cyanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloroethoxymethyl-[4-(dimethylamino)-6-methylsulfanyl-1,3,5-triazin-2-yl]cyanamide?
The IUPAC name of 2-chloroethoxymethyl-[4-(dimethylamino)-6-methylsulfanyl-1,3,5-triazin-2-yl]cyanamide (CID 611073) is 2-chloroethoxymethyl-[4-(dimethylamino)-6-methylsulfanyl-1,3,5-triazin-2-yl]cyanamide.
What is the SMILES notation for 2-chloroethoxymethyl-[4-(dimethylamino)-6-methylsulfanyl-1,3,5-triazin-2-yl]cyanamide?
The canonical SMILES for 2-chloroethoxymethyl-[4-(dimethylamino)-6-methylsulfanyl-1,3,5-triazin-2-yl]cyanamide is CSc1nc(N(C)C)nc(N(C#N)COCCCl)n1.
What is the InChIKey of 2-chloroethoxymethyl-[4-(dimethylamino)-6-methylsulfanyl-1,3,5-triazin-2-yl]cyanamide?
The InChIKey is LRRCPWAJAMDTRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15ClN6OS/c1-16(2)8-13-9(15-10(14-8)19-3)17(6-12)7-18-5-4-11/h4-5,7H2,1-3H3.
What are the key properties of 2-chloroethoxymethyl-[4-(dimethylamino)-6-methylsulfanyl-1,3,5-triazin-2-yl]cyanamide?
2-chloroethoxymethyl-[4-(dimethylamino)-6-methylsulfanyl-1,3,5-triazin-2-yl]cyanamide has a molecular weight of 302.79 g/mol, XLogP of 1.16, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloroethoxymethyl-[4-(dimethylamino)-6-methylsulfanyl-1,3,5-triazin-2-yl]cyanamide is sourced from PubChem (CID 611073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).