About methyl 4-[[2-(3-amino-1,2,4-triazol-1-yl)acetyl]-methylamino]butanoate
methyl 4-[[2-(3-amino-1,2,4-triazol-1-yl)acetyl]-methylamino]butanoate (PubChem CID 61107923) has the molecular formula C10H17N5O3
and a molecular weight of 255.28 g/mol. Its IUPAC name is methyl 4-[[2-(3-amino-1,2,4-triazol-1-yl)acetyl]-methylamino]butanoate.
Molecular Properties
| Compound Name | methyl 4-[[2-(3-amino-1,2,4-triazol-1-yl)acetyl]-methylamino]butanoate |
| PubChem CID | 61107923 |
| Molecular Formula | C10H17N5O3 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | methyl 4-[[2-(3-amino-1,2,4-triazol-1-yl)acetyl]-methylamino]butanoate |
| SMILES | COC(=O)CCCN(C)C(=O)Cn1cnc(N)n1 |
| InChI | InChI=1S/C10H17N5O3/c1-14(5-3-4-9(17)18-2)8(16)6-15-7-12-10(11)13-15/h7H,3-6H2,1-2H3,(H2,11,13) |
| InChIKey | RAUVTELNMHASPV-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 103.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 4-[[2-(3-amino-1,2,4-triazol-1-yl)acetyl]-methylamino]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[[2-(3-amino-1,2,4-triazol-1-yl)acetyl]-methylamino]butanoate?
The IUPAC name of methyl 4-[[2-(3-amino-1,2,4-triazol-1-yl)acetyl]-methylamino]butanoate (CID 61107923) is methyl 4-[[2-(3-amino-1,2,4-triazol-1-yl)acetyl]-methylamino]butanoate.
What is the SMILES notation for methyl 4-[[2-(3-amino-1,2,4-triazol-1-yl)acetyl]-methylamino]butanoate?
The canonical SMILES for methyl 4-[[2-(3-amino-1,2,4-triazol-1-yl)acetyl]-methylamino]butanoate is COC(=O)CCCN(C)C(=O)Cn1cnc(N)n1.
What is the InChIKey of methyl 4-[[2-(3-amino-1,2,4-triazol-1-yl)acetyl]-methylamino]butanoate?
The InChIKey is RAUVTELNMHASPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N5O3/c1-14(5-3-4-9(17)18-2)8(16)6-15-7-12-10(11)13-15/h7H,3-6H2,1-2H3,(H2,11,13).
What are the key properties of methyl 4-[[2-(3-amino-1,2,4-triazol-1-yl)acetyl]-methylamino]butanoate?
methyl 4-[[2-(3-amino-1,2,4-triazol-1-yl)acetyl]-methylamino]butanoate has a molecular weight of 255.28 g/mol, XLogP of -0.73, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[[2-(3-amino-1,2,4-triazol-1-yl)acetyl]-methylamino]butanoate is sourced from PubChem (CID 61107923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).