C12H22N4O4S — CID 61108453
4-[4-(2-ethoxyethoxy)piperidin-1-yl]sulfonyl-1H-pyrazol-5-amine (PubChem CID 61108453) has the molecular formula C12H22N4O4S and a molecular weight of 318.40 g/mol. Its IUPAC name is 4-[4-(2-ethoxyethoxy)piperidin-1-yl]sulfonyl-1H-pyrazol-5-amine.
| Compound Name | 4-[4-(2-ethoxyethoxy)piperidin-1-yl]sulfonyl-1H-pyrazol-5-amine |
|---|---|
| PubChem CID | 61108453 |
| Molecular Formula | C12H22N4O4S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 4-[4-(2-ethoxyethoxy)piperidin-1-yl]sulfonyl-1H-pyrazol-5-amine |
| SMILES | CCOCCOC1CCN(S(=O)(=O)c2cn[nH]c2N)CC1 |
| InChI | InChI=1S/C12H22N4O4S/c1-2-19-7-8-20-10-3-5-16(6-4-10)21(17,18)11-9-14-15-12(11)13/h9-10H,2-8H2,1H3,(H3,13,14,15) |
| InChIKey | NNSJBXMACYDGIY-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 110.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|