C12H16Br2N2O3S — CID 61109769
4-amino-2,6-dibromo-N-cyclopropyl-N-(2-methoxyethyl)benzenesulfonamide (PubChem CID 61109769) has the molecular formula C12H16Br2N2O3S and a molecular weight of 428.15 g/mol. Its IUPAC name is 4-amino-2,6-dibromo-N-cyclopropyl-N-(2-methoxyethyl)benzenesulfonamide.
| Compound Name | 4-amino-2,6-dibromo-N-cyclopropyl-N-(2-methoxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 61109769 |
| Molecular Formula | C12H16Br2N2O3S |
| Molecular Weight | 428.15 g/mol |
| Exact Mass | 425.92 |
| IUPAC Name | 4-amino-2,6-dibromo-N-cyclopropyl-N-(2-methoxyethyl)benzenesulfonamide |
| SMILES | COCCN(C1CC1)S(=O)(=O)c1c(Br)cc(N)cc1Br |
| InChI | InChI=1S/C12H16Br2N2O3S/c1-19-5-4-16(9-2-3-9)20(17,18)12-10(13)6-8(15)7-11(12)14/h6-7,9H,2-5,15H2,1H3 |
| InChIKey | HWMXOASLKVBENH-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.15 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|