C14H18N4O2 — CID 61109940
2,4-diamino-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-methylbenzamide (PubChem CID 61109940) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is 2,4-diamino-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-methylbenzamide.
| Compound Name | 2,4-diamino-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 61109940 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 2,4-diamino-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-methylbenzamide |
| SMILES | Cc1noc(C)c1CN(C)C(=O)c1ccc(N)cc1N |
| InChI | InChI=1S/C14H18N4O2/c1-8-12(9(2)20-17-8)7-18(3)14(19)11-5-4-10(15)6-13(11)16/h4-6H,7,15-16H2,1-3H3 |
| InChIKey | YMGKVLFEVGHTPJ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 98.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|