C16H18FN3O — CID 61111115
3,5-diamino-N-[1-(4-fluorophenyl)ethyl]-N-methylbenzamide (PubChem CID 61111115) has the molecular formula C16H18FN3O and a molecular weight of 287.34 g/mol. Its IUPAC name is 3,5-diamino-N-[1-(4-fluorophenyl)ethyl]-N-methylbenzamide.
| Compound Name | 3,5-diamino-N-[1-(4-fluorophenyl)ethyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 61111115 |
| Molecular Formula | C16H18FN3O |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 3,5-diamino-N-[1-(4-fluorophenyl)ethyl]-N-methylbenzamide |
| SMILES | CC(c1ccc(F)cc1)N(C)C(=O)c1cc(N)cc(N)c1 |
| InChI | InChI=1S/C16H18FN3O/c1-10(11-3-5-13(17)6-4-11)20(2)16(21)12-7-14(18)9-15(19)8-12/h3-10H,18-19H2,1-2H3 |
| InChIKey | KRTJHYRLDJOBRB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|