C9H9F2N5O2S — CID 61111935
5-amino-2,4-difluoro-N-(1H-1,2,4-triazol-5-ylmethyl)benzenesulfonamide (PubChem CID 61111935) has the molecular formula C9H9F2N5O2S and a molecular weight of 289.27 g/mol. Its IUPAC name is 5-amino-2,4-difluoro-N-(1H-1,2,4-triazol-5-ylmethyl)benzenesulfonamide.
| Compound Name | 5-amino-2,4-difluoro-N-(1H-1,2,4-triazol-5-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 61111935 |
| Molecular Formula | C9H9F2N5O2S |
| Molecular Weight | 289.27 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | 5-amino-2,4-difluoro-N-(1H-1,2,4-triazol-5-ylmethyl)benzenesulfonamide |
| SMILES | Nc1cc(S(=O)(=O)NCc2ncn[nH]2)c(F)cc1F |
| InChI | InChI=1S/C9H9F2N5O2S/c10-5-1-6(11)8(2-7(5)12)19(17,18)15-3-9-13-4-14-16-9/h1-2,4,15H,3,12H2,(H,13,14,16) |
| InChIKey | VHELMZPUYITXMF-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.27 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|