C12H14N6O2S — CID 61112113
3-amino-1-ethyl-N-(1H-indazol-4-yl)pyrazole-4-sulfonamide (PubChem CID 61112113) has the molecular formula C12H14N6O2S and a molecular weight of 306.35 g/mol. Its IUPAC name is 3-amino-1-ethyl-N-(1H-indazol-4-yl)pyrazole-4-sulfonamide.
| Compound Name | 3-amino-1-ethyl-N-(1H-indazol-4-yl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 61112113 |
| Molecular Formula | C12H14N6O2S |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 3-amino-1-ethyl-N-(1H-indazol-4-yl)pyrazole-4-sulfonamide |
| SMILES | CCn1cc(S(=O)(=O)Nc2cccc3[nH]ncc23)c(N)n1 |
| InChI | InChI=1S/C12H14N6O2S/c1-2-18-7-11(12(13)16-18)21(19,20)17-10-5-3-4-9-8(10)6-14-15-9/h3-7,17H,2H2,1H3,(H2,13,16)(H,14,15) |
| InChIKey | ZLYYEFHESLAZPU-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 118.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |