C21H24N2O — CID 6111341
(E)-1-(2,4-dimethylphenyl)-3-(4-phenylpiperazin-1-yl)prop-2-en-1-one (PubChem CID 6111341) has the molecular formula C21H24N2O and a molecular weight of 320.44 g/mol. Its IUPAC name is (E)-1-(2,4-dimethylphenyl)-3-(4-phenylpiperazin-1-yl)prop-2-en-1-one.
| Compound Name | (E)-1-(2,4-dimethylphenyl)-3-(4-phenylpiperazin-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 6111341 |
| Molecular Formula | C21H24N2O |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | (E)-1-(2,4-dimethylphenyl)-3-(4-phenylpiperazin-1-yl)prop-2-en-1-one |
| SMILES | Cc1ccc(C(=O)/C=C/N2CCN(c3ccccc3)CC2)c(C)c1 |
| InChI | InChI=1S/C21H24N2O/c1-17-8-9-20(18(2)16-17)21(24)10-11-22-12-14-23(15-13-22)19-6-4-3-5-7-19/h3-11,16H,12-15H2,1-2H3/b11-10+ |
| InChIKey | GEHRSRPQKFBQJX-ZHACJKMWSA-N |
| XLogP | 3.82 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|