C11H11Cl2F3N2O2 — CID 61115392
3-amino-4,5-dichloro-N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 61115392) has the molecular formula C11H11Cl2F3N2O2 and a molecular weight of 331.12 g/mol. Its IUPAC name is 3-amino-4,5-dichloro-N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 3-amino-4,5-dichloro-N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 61115392 |
| Molecular Formula | C11H11Cl2F3N2O2 |
| Molecular Weight | 331.12 g/mol |
| Exact Mass | 330.01 |
| IUPAC Name | 3-amino-4,5-dichloro-N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | Nc1cc(C(=O)N(CCO)CC(F)(F)F)cc(Cl)c1Cl |
| InChI | InChI=1S/C11H11Cl2F3N2O2/c12-7-3-6(4-8(17)9(7)13)10(20)18(1-2-19)5-11(14,15)16/h3-4,19H,1-2,5,17H2 |
| InChIKey | FHWRJOBYPVWOJQ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.12 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|