C11H15N3O — CID 61117214
4-amino-1-cyclopropyl-N-prop-2-enylpyrrole-2-carboxamide (PubChem CID 61117214) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is 4-amino-1-cyclopropyl-N-prop-2-enylpyrrole-2-carboxamide.
| Compound Name | 4-amino-1-cyclopropyl-N-prop-2-enylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 61117214 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | 4-amino-1-cyclopropyl-N-prop-2-enylpyrrole-2-carboxamide |
| SMILES | C=CCNC(=O)c1cc(N)cn1C1CC1 |
| InChI | InChI=1S/C11H15N3O/c1-2-5-13-11(15)10-6-8(12)7-14(10)9-3-4-9/h2,6-7,9H,1,3-5,12H2,(H,13,15) |
| InChIKey | WZIVRVYARBBYRU-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|