C18H24N2O — CID 61118969
N-(1-cyano-4-ethylcyclohexyl)-2,5-dimethylbenzamide (PubChem CID 61118969) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is N-(1-cyano-4-ethylcyclohexyl)-2,5-dimethylbenzamide.
| Compound Name | N-(1-cyano-4-ethylcyclohexyl)-2,5-dimethylbenzamide |
|---|---|
| PubChem CID | 61118969 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | N-(1-cyano-4-ethylcyclohexyl)-2,5-dimethylbenzamide |
| SMILES | CCC1CCC(C#N)(NC(=O)c2cc(C)ccc2C)CC1 |
| InChI | InChI=1S/C18H24N2O/c1-4-15-7-9-18(12-19,10-8-15)20-17(21)16-11-13(2)5-6-14(16)3/h5-6,11,15H,4,7-10H2,1-3H3,(H,20,21) |
| InChIKey | LEZBBGMXAPXDLW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |