C10H20N2O2S2 — CID 61119255
2-(cyclohexylsulfonylamino)-2-methylpropanethioamide (PubChem CID 61119255) has the molecular formula C10H20N2O2S2 and a molecular weight of 264.42 g/mol. Its IUPAC name is 2-(cyclohexylsulfonylamino)-2-methylpropanethioamide.
| Compound Name | 2-(cyclohexylsulfonylamino)-2-methylpropanethioamide |
|---|---|
| PubChem CID | 61119255 |
| Molecular Formula | C10H20N2O2S2 |
| Molecular Weight | 264.42 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 2-(cyclohexylsulfonylamino)-2-methylpropanethioamide |
| SMILES | CC(C)(NS(=O)(=O)C1CCCCC1)C(N)=S |
| InChI | InChI=1S/C10H20N2O2S2/c1-10(2,9(11)15)12-16(13,14)8-6-4-3-5-7-8/h8,12H,3-7H2,1-2H3,(H2,11,15) |
| InChIKey | JZKKDQNABWVXNF-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.42 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|