C16H22N2OS2 — CID 61120338
N-(1-carbamothioylcyclohexyl)-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide (PubChem CID 61120338) has the molecular formula C16H22N2OS2 and a molecular weight of 322.50 g/mol. Its IUPAC name is N-(1-carbamothioylcyclohexyl)-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide.
| Compound Name | N-(1-carbamothioylcyclohexyl)-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 61120338 |
| Molecular Formula | C16H22N2OS2 |
| Molecular Weight | 322.50 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | N-(1-carbamothioylcyclohexyl)-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
| SMILES | NC(=S)C1(NC(=O)c2cc3c(s2)CCCC3)CCCCC1 |
| InChI | InChI=1S/C16H22N2OS2/c17-15(20)16(8-4-1-5-9-16)18-14(19)13-10-11-6-2-3-7-12(11)21-13/h10H,1-9H2,(H2,17,20)(H,18,19) |
| InChIKey | UBLINWKGJJBRRW-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.50 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|