C14H16N2O2 — CID 61120374
N-(2-cyanobutan-2-yl)-2,3-dihydro-1-benzofuran-2-carboxamide (PubChem CID 61120374) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is N-(2-cyanobutan-2-yl)-2,3-dihydro-1-benzofuran-2-carboxamide.
| Compound Name | N-(2-cyanobutan-2-yl)-2,3-dihydro-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 61120374 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | N-(2-cyanobutan-2-yl)-2,3-dihydro-1-benzofuran-2-carboxamide |
| SMILES | CCC(C)(C#N)NC(=O)C1Cc2ccccc2O1 |
| InChI | InChI=1S/C14H16N2O2/c1-3-14(2,9-15)16-13(17)12-8-10-6-4-5-7-11(10)18-12/h4-7,12H,3,8H2,1-2H3,(H,16,17) |
| InChIKey | STZIPZFEUBBGQP-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |