About N-(1-cyanobutyl)-3,3,3-trifluoropropanamide
N-(1-cyanobutyl)-3,3,3-trifluoropropanamide (PubChem CID 61121265) has the molecular formula C8H11F3N2O
and a molecular weight of 208.18 g/mol. Its IUPAC name is N-(1-cyanobutyl)-3,3,3-trifluoropropanamide.
Molecular Properties
| Compound Name | N-(1-cyanobutyl)-3,3,3-trifluoropropanamide |
| PubChem CID | 61121265 |
| Molecular Formula | C8H11F3N2O |
| Molecular Weight | 208.18 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | N-(1-cyanobutyl)-3,3,3-trifluoropropanamide |
| SMILES | CCCC(C#N)NC(=O)CC(F)(F)F |
| InChI | InChI=1S/C8H11F3N2O/c1-2-3-6(5-12)13-7(14)4-8(9,10)11/h6H,2-4H2,1H3,(H,13,14) |
| InChIKey | JVZQBDFMSFJGMT-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.18 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(1-cyanobutyl)-3,3,3-trifluoropropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-cyanobutyl)-3,3,3-trifluoropropanamide?
The IUPAC name of N-(1-cyanobutyl)-3,3,3-trifluoropropanamide (CID 61121265) is N-(1-cyanobutyl)-3,3,3-trifluoropropanamide.
What is the SMILES notation for N-(1-cyanobutyl)-3,3,3-trifluoropropanamide?
The canonical SMILES for N-(1-cyanobutyl)-3,3,3-trifluoropropanamide is CCCC(C#N)NC(=O)CC(F)(F)F.
What is the InChIKey of N-(1-cyanobutyl)-3,3,3-trifluoropropanamide?
The InChIKey is JVZQBDFMSFJGMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11F3N2O/c1-2-3-6(5-12)13-7(14)4-8(9,10)11/h6H,2-4H2,1H3,(H,13,14).
What are the key properties of N-(1-cyanobutyl)-3,3,3-trifluoropropanamide?
N-(1-cyanobutyl)-3,3,3-trifluoropropanamide has a molecular weight of 208.18 g/mol, XLogP of 1.75, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-cyanobutyl)-3,3,3-trifluoropropanamide is sourced from PubChem (CID 61121265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).