C12H24N4O2S2 — CID 61121993
1-methyl-4-(piperidin-1-ylsulfonylamino)piperidine-4-carbothioamide (PubChem CID 61121993) has the molecular formula C12H24N4O2S2 and a molecular weight of 320.48 g/mol. Its IUPAC name is 1-methyl-4-(piperidin-1-ylsulfonylamino)piperidine-4-carbothioamide.
| Compound Name | 1-methyl-4-(piperidin-1-ylsulfonylamino)piperidine-4-carbothioamide |
|---|---|
| PubChem CID | 61121993 |
| Molecular Formula | C12H24N4O2S2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 1-methyl-4-(piperidin-1-ylsulfonylamino)piperidine-4-carbothioamide |
| SMILES | CN1CCC(NS(=O)(=O)N2CCCCC2)(C(N)=S)CC1 |
| InChI | InChI=1S/C12H24N4O2S2/c1-15-9-5-12(6-10-15,11(13)19)14-20(17,18)16-7-3-2-4-8-16/h14H,2-10H2,1H3,(H2,13,19) |
| InChIKey | GRTQJFDYQIGABS-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|