C11H23N3O2S2 — CID 61122078
1-(diethylsulfamoylamino)cyclohexane-1-carbothioamide (PubChem CID 61122078) has the molecular formula C11H23N3O2S2 and a molecular weight of 293.46 g/mol. Its IUPAC name is 1-(diethylsulfamoylamino)cyclohexane-1-carbothioamide.
| Compound Name | 1-(diethylsulfamoylamino)cyclohexane-1-carbothioamide |
|---|---|
| PubChem CID | 61122078 |
| Molecular Formula | C11H23N3O2S2 |
| Molecular Weight | 293.46 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 1-(diethylsulfamoylamino)cyclohexane-1-carbothioamide |
| SMILES | CCN(CC)S(=O)(=O)NC1(C(N)=S)CCCCC1 |
| InChI | InChI=1S/C11H23N3O2S2/c1-3-14(4-2)18(15,16)13-11(10(12)17)8-6-5-7-9-11/h13H,3-9H2,1-2H3,(H2,12,17) |
| InChIKey | NKSDMNPDAFMVTE-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.46 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|