C14H27N3O2S2 — CID 61122677
1-[(3-methylpiperidin-1-yl)sulfonylamino]cycloheptane-1-carbothioamide (PubChem CID 61122677) has the molecular formula C14H27N3O2S2 and a molecular weight of 333.52 g/mol. Its IUPAC name is 1-[(3-methylpiperidin-1-yl)sulfonylamino]cycloheptane-1-carbothioamide.
| Compound Name | 1-[(3-methylpiperidin-1-yl)sulfonylamino]cycloheptane-1-carbothioamide |
|---|---|
| PubChem CID | 61122677 |
| Molecular Formula | C14H27N3O2S2 |
| Molecular Weight | 333.52 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 1-[(3-methylpiperidin-1-yl)sulfonylamino]cycloheptane-1-carbothioamide |
| SMILES | CC1CCCN(S(=O)(=O)NC2(C(N)=S)CCCCCC2)C1 |
| InChI | InChI=1S/C14H27N3O2S2/c1-12-7-6-10-17(11-12)21(18,19)16-14(13(15)20)8-4-2-3-5-9-14/h12,16H,2-11H2,1H3,(H2,15,20) |
| InChIKey | PCJKANCAULFXJO-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.52 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|