C14H26N2O2S2 — CID 61123082
1-(cyclohexylsulfonylamino)cycloheptane-1-carbothioamide (PubChem CID 61123082) has the molecular formula C14H26N2O2S2 and a molecular weight of 318.51 g/mol. Its IUPAC name is 1-(cyclohexylsulfonylamino)cycloheptane-1-carbothioamide.
| Compound Name | 1-(cyclohexylsulfonylamino)cycloheptane-1-carbothioamide |
|---|---|
| PubChem CID | 61123082 |
| Molecular Formula | C14H26N2O2S2 |
| Molecular Weight | 318.51 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 1-(cyclohexylsulfonylamino)cycloheptane-1-carbothioamide |
| SMILES | NC(=S)C1(NS(=O)(=O)C2CCCCC2)CCCCCC1 |
| InChI | InChI=1S/C14H26N2O2S2/c15-13(19)14(10-6-1-2-7-11-14)16-20(17,18)12-8-4-3-5-9-12/h12,16H,1-11H2,(H2,15,19) |
| InChIKey | GWBJFRDNCUQSPE-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.51 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|