C26H24F6O — CID 6112322
(2E,6E)-4-tert-butyl-2,6-bis[[3-(trifluoromethyl)phenyl]methylidene]cyclohexan-1-one (PubChem CID 6112322) has the molecular formula C26H24F6O and a molecular weight of 466.47 g/mol. Its IUPAC name is (2E,6E)-4-tert-butyl-2,6-bis[[3-(trifluoromethyl)phenyl]methylidene]cyclohexan-1-one.
| Compound Name | (2E,6E)-4-tert-butyl-2,6-bis[[3-(trifluoromethyl)phenyl]methylidene]cyclohexan-1-one |
|---|---|
| PubChem CID | 6112322 |
| Molecular Formula | C26H24F6O |
| Molecular Weight | 466.47 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | (2E,6E)-4-tert-butyl-2,6-bis[[3-(trifluoromethyl)phenyl]methylidene]cyclohexan-1-one |
| SMILES | CC(C)(C)C1C/C(=C\c2cccc(C(F)(F)F)c2)C(=O)/C(=C/c2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C26H24F6O/c1-24(2,3)22-14-18(10-16-6-4-8-20(12-16)25(27,28)29)23(33)19(15-22)11-17-7-5-9-21(13-17)26(30,31)32/h4-13,22H,14-15H2,1-3H3/b18-10+,19-11+ |
| InChIKey | BEVJHKXUSQSOCX-XOBNHNQQSA-N |
| XLogP | 8.22 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.47 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|