C12H22N2O2S2 — CID 61123775
1-(1,1-dioxo-1,2-thiazolidin-2-yl)cyclooctane-1-carbothioamide (PubChem CID 61123775) has the molecular formula C12H22N2O2S2 and a molecular weight of 290.45 g/mol. Its IUPAC name is 1-(1,1-dioxo-1,2-thiazolidin-2-yl)cyclooctane-1-carbothioamide.
| Compound Name | 1-(1,1-dioxo-1,2-thiazolidin-2-yl)cyclooctane-1-carbothioamide |
|---|---|
| PubChem CID | 61123775 |
| Molecular Formula | C12H22N2O2S2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 1-(1,1-dioxo-1,2-thiazolidin-2-yl)cyclooctane-1-carbothioamide |
| SMILES | NC(=S)C1(N2CCCS2(=O)=O)CCCCCCC1 |
| InChI | InChI=1S/C12H22N2O2S2/c13-11(17)12(7-4-2-1-3-5-8-12)14-9-6-10-18(14,15)16/h1-10H2,(H2,13,17) |
| InChIKey | KYWVOTTVIGHGJF-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|