C10H16F2N2O2S — CID 61123890
N-(1-cyano-4-ethylcyclohexyl)-1,1-difluoromethanesulfonamide (PubChem CID 61123890) has the molecular formula C10H16F2N2O2S and a molecular weight of 266.31 g/mol. Its IUPAC name is N-(1-cyano-4-ethylcyclohexyl)-1,1-difluoromethanesulfonamide.
| Compound Name | N-(1-cyano-4-ethylcyclohexyl)-1,1-difluoromethanesulfonamide |
|---|---|
| PubChem CID | 61123890 |
| Molecular Formula | C10H16F2N2O2S |
| Molecular Weight | 266.31 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | N-(1-cyano-4-ethylcyclohexyl)-1,1-difluoromethanesulfonamide |
| SMILES | CCC1CCC(C#N)(NS(=O)(=O)C(F)F)CC1 |
| InChI | InChI=1S/C10H16F2N2O2S/c1-2-8-3-5-10(7-13,6-4-8)14-17(15,16)9(11)12/h8-9,14H,2-6H2,1H3 |
| InChIKey | ZJHJIHWSCCXUGR-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.31 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |