C11H12F2N2O2S — CID 61124655
N-(1-cyanobutyl)-2,4-difluorobenzenesulfonamide (PubChem CID 61124655) has the molecular formula C11H12F2N2O2S and a molecular weight of 274.29 g/mol. Its IUPAC name is N-(1-cyanobutyl)-2,4-difluorobenzenesulfonamide.
| Compound Name | N-(1-cyanobutyl)-2,4-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 61124655 |
| Molecular Formula | C11H12F2N2O2S |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | N-(1-cyanobutyl)-2,4-difluorobenzenesulfonamide |
| SMILES | CCCC(C#N)NS(=O)(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C11H12F2N2O2S/c1-2-3-9(7-14)15-18(16,17)11-5-4-8(12)6-10(11)13/h4-6,9,15H,2-3H2,1H3 |
| InChIKey | SQNFRVMEVNLFBE-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |