C12H23N3O2S2 — CID 61124855
1-[(4-methylpiperidin-1-yl)sulfonylamino]cyclopentane-1-carbothioamide (PubChem CID 61124855) has the molecular formula C12H23N3O2S2 and a molecular weight of 305.47 g/mol. Its IUPAC name is 1-[(4-methylpiperidin-1-yl)sulfonylamino]cyclopentane-1-carbothioamide.
| Compound Name | 1-[(4-methylpiperidin-1-yl)sulfonylamino]cyclopentane-1-carbothioamide |
|---|---|
| PubChem CID | 61124855 |
| Molecular Formula | C12H23N3O2S2 |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 1-[(4-methylpiperidin-1-yl)sulfonylamino]cyclopentane-1-carbothioamide |
| SMILES | CC1CCN(S(=O)(=O)NC2(C(N)=S)CCCC2)CC1 |
| InChI | InChI=1S/C12H23N3O2S2/c1-10-4-8-15(9-5-10)19(16,17)14-12(11(13)18)6-2-3-7-12/h10,14H,2-9H2,1H3,(H2,13,18) |
| InChIKey | FPYXHLGKJFUPIP-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|