C14H23N3O3S — CID 61125157
3-[(2-amino-6-methylphenyl)sulfonylamino]-N,N-diethylpropanamide (PubChem CID 61125157) has the molecular formula C14H23N3O3S and a molecular weight of 313.42 g/mol. Its IUPAC name is 3-[(2-amino-6-methylphenyl)sulfonylamino]-N,N-diethylpropanamide.
| Compound Name | 3-[(2-amino-6-methylphenyl)sulfonylamino]-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 61125157 |
| Molecular Formula | C14H23N3O3S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 3-[(2-amino-6-methylphenyl)sulfonylamino]-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)CCNS(=O)(=O)c1c(C)cccc1N |
| InChI | InChI=1S/C14H23N3O3S/c1-4-17(5-2)13(18)9-10-16-21(19,20)14-11(3)7-6-8-12(14)15/h6-8,16H,4-5,9-10,15H2,1-3H3 |
| InChIKey | JDPQDALPFAEUNQ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|