C11H18N4O4S2 — CID 61125660
4-(3-amino-2-methylphenyl)sulfonylpiperazine-1-sulfonamide (PubChem CID 61125660) has the molecular formula C11H18N4O4S2 and a molecular weight of 334.42 g/mol. Its IUPAC name is 4-(3-amino-2-methylphenyl)sulfonylpiperazine-1-sulfonamide.
| Compound Name | 4-(3-amino-2-methylphenyl)sulfonylpiperazine-1-sulfonamide |
|---|---|
| PubChem CID | 61125660 |
| Molecular Formula | C11H18N4O4S2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 4-(3-amino-2-methylphenyl)sulfonylpiperazine-1-sulfonamide |
| SMILES | Cc1c(N)cccc1S(=O)(=O)N1CCN(S(N)(=O)=O)CC1 |
| InChI | InChI=1S/C11H18N4O4S2/c1-9-10(12)3-2-4-11(9)20(16,17)14-5-7-15(8-6-14)21(13,18)19/h2-4H,5-8,12H2,1H3,(H2,13,18,19) |
| InChIKey | WCNGFYYQWXFXQU-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 126.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|