C12H19N3O3S — CID 61126072
3-[(3-amino-5-methylphenyl)sulfonylamino]-N,N-dimethylpropanamide (PubChem CID 61126072) has the molecular formula C12H19N3O3S and a molecular weight of 285.37 g/mol. Its IUPAC name is 3-[(3-amino-5-methylphenyl)sulfonylamino]-N,N-dimethylpropanamide.
| Compound Name | 3-[(3-amino-5-methylphenyl)sulfonylamino]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 61126072 |
| Molecular Formula | C12H19N3O3S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 3-[(3-amino-5-methylphenyl)sulfonylamino]-N,N-dimethylpropanamide |
| SMILES | Cc1cc(N)cc(S(=O)(=O)NCCC(=O)N(C)C)c1 |
| InChI | InChI=1S/C12H19N3O3S/c1-9-6-10(13)8-11(7-9)19(17,18)14-5-4-12(16)15(2)3/h6-8,14H,4-5,13H2,1-3H3 |
| InChIKey | FETCFFBFXLTFSZ-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|