C21H40N2O3 — CID 611276
N,N'-diheptyl-N,N'-dimethyl-2-oxopentanediamide (PubChem CID 611276) has the molecular formula C21H40N2O3 and a molecular weight of 368.56 g/mol. Its IUPAC name is N,N'-diheptyl-N,N'-dimethyl-2-oxopentanediamide.
| Compound Name | N,N'-diheptyl-N,N'-dimethyl-2-oxopentanediamide |
|---|---|
| PubChem CID | 611276 |
| Molecular Formula | C21H40N2O3 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.30 |
| IUPAC Name | N,N'-diheptyl-N,N'-dimethyl-2-oxopentanediamide |
| SMILES | CCCCCCCN(C)C(=O)CCC(=O)C(=O)N(C)CCCCCCC |
| InChI | InChI=1S/C21H40N2O3/c1-5-7-9-11-13-17-22(3)20(25)16-15-19(24)21(26)23(4)18-14-12-10-8-6-2/h5-18H2,1-4H3 |
| InChIKey | IESHUYGQAQJGEF-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|