C11H16ClN3O3S — CID 61127654
3-[(2-amino-5-chlorophenyl)sulfonylamino]-N,N-dimethylpropanamide (PubChem CID 61127654) has the molecular formula C11H16ClN3O3S and a molecular weight of 305.79 g/mol. Its IUPAC name is 3-[(2-amino-5-chlorophenyl)sulfonylamino]-N,N-dimethylpropanamide.
| Compound Name | 3-[(2-amino-5-chlorophenyl)sulfonylamino]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 61127654 |
| Molecular Formula | C11H16ClN3O3S |
| Molecular Weight | 305.79 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 3-[(2-amino-5-chlorophenyl)sulfonylamino]-N,N-dimethylpropanamide |
| SMILES | CN(C)C(=O)CCNS(=O)(=O)c1cc(Cl)ccc1N |
| InChI | InChI=1S/C11H16ClN3O3S/c1-15(2)11(16)5-6-14-19(17,18)10-7-8(12)3-4-9(10)13/h3-4,7,14H,5-6,13H2,1-2H3 |
| InChIKey | DLXLUHUZEAEMDH-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.79 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|