C9H15N5O3S — CID 61128287
1-[2-(1,2,4-triazol-1-yl)acetyl]piperidine-3-sulfonamide (PubChem CID 61128287) has the molecular formula C9H15N5O3S and a molecular weight of 273.32 g/mol. Its IUPAC name is 1-[2-(1,2,4-triazol-1-yl)acetyl]piperidine-3-sulfonamide.
| Compound Name | 1-[2-(1,2,4-triazol-1-yl)acetyl]piperidine-3-sulfonamide |
|---|---|
| PubChem CID | 61128287 |
| Molecular Formula | C9H15N5O3S |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 1-[2-(1,2,4-triazol-1-yl)acetyl]piperidine-3-sulfonamide |
| SMILES | NS(=O)(=O)C1CCCN(C(=O)Cn2cncn2)C1 |
| InChI | InChI=1S/C9H15N5O3S/c10-18(16,17)8-2-1-3-13(4-8)9(15)5-14-7-11-6-12-14/h6-8H,1-5H2,(H2,10,16,17) |
| InChIKey | OBSHPOYDJONOJZ-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 111.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |