C9H14N4O3S2 — CID 61130893
4-(4-methyl-1,3-thiazole-5-carbonyl)piperazine-1-sulfonamide (PubChem CID 61130893) has the molecular formula C9H14N4O3S2 and a molecular weight of 290.37 g/mol. Its IUPAC name is 4-(4-methyl-1,3-thiazole-5-carbonyl)piperazine-1-sulfonamide.
| Compound Name | 4-(4-methyl-1,3-thiazole-5-carbonyl)piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 61130893 |
| Molecular Formula | C9H14N4O3S2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 4-(4-methyl-1,3-thiazole-5-carbonyl)piperazine-1-sulfonamide |
| SMILES | Cc1ncsc1C(=O)N1CCN(S(N)(=O)=O)CC1 |
| InChI | InChI=1S/C9H14N4O3S2/c1-7-8(17-6-11-7)9(14)12-2-4-13(5-3-12)18(10,15)16/h6H,2-5H2,1H3,(H2,10,15,16) |
| InChIKey | LVDNQHZPHLGDOG-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 96.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |