C8H20N2O2S — CID 61134416
N-(1-amino-2-methylbutan-2-yl)propane-2-sulfonamide (PubChem CID 61134416) has the molecular formula C8H20N2O2S and a molecular weight of 208.33 g/mol. Its IUPAC name is N-(1-amino-2-methylbutan-2-yl)propane-2-sulfonamide.
| Compound Name | N-(1-amino-2-methylbutan-2-yl)propane-2-sulfonamide |
|---|---|
| PubChem CID | 61134416 |
| Molecular Formula | C8H20N2O2S |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | N-(1-amino-2-methylbutan-2-yl)propane-2-sulfonamide |
| SMILES | CCC(C)(CN)NS(=O)(=O)C(C)C |
| InChI | InChI=1S/C8H20N2O2S/c1-5-8(4,6-9)10-13(11,12)7(2)3/h7,10H,5-6,9H2,1-4H3 |
| InChIKey | QPEJFCPOBKJTJI-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |