About (2S)-2-[(2,6-difluorophenyl)sulfonylamino]-3-methylbutanoic acid
(2S)-2-[(2,6-difluorophenyl)sulfonylamino]-3-methylbutanoic acid (PubChem CID 61136251) has the molecular formula C11H13F2NO4S
and a molecular weight of 293.29 g/mol. Its IUPAC name is (2S)-2-[(2,6-difluorophenyl)sulfonylamino]-3-methylbutanoic acid.
Molecular Properties
| Compound Name | (2S)-2-[(2,6-difluorophenyl)sulfonylamino]-3-methylbutanoic acid |
| PubChem CID | 61136251 |
| Molecular Formula | C11H13F2NO4S |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | (2S)-2-[(2,6-difluorophenyl)sulfonylamino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](NS(=O)(=O)c1c(F)cccc1F)C(=O)O |
| InChI | InChI=1S/C11H13F2NO4S/c1-6(2)9(11(15)16)14-19(17,18)10-7(12)4-3-5-8(10)13/h3-6,9,14H,1-2H3,(H,15,16)/t9-/m0/s1 |
| InChIKey | PWJKNXONDMMVEM-VIFPVBQESA-N |
| XLogP | 1.35 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-2-[(2,6-difluorophenyl)sulfonylamino]-3-methylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[(2,6-difluorophenyl)sulfonylamino]-3-methylbutanoic acid?
The IUPAC name of (2S)-2-[(2,6-difluorophenyl)sulfonylamino]-3-methylbutanoic acid (CID 61136251) is (2S)-2-[(2,6-difluorophenyl)sulfonylamino]-3-methylbutanoic acid.
What is the SMILES notation for (2S)-2-[(2,6-difluorophenyl)sulfonylamino]-3-methylbutanoic acid?
The canonical SMILES for (2S)-2-[(2,6-difluorophenyl)sulfonylamino]-3-methylbutanoic acid is CC(C)[C@H](NS(=O)(=O)c1c(F)cccc1F)C(=O)O.
What is the InChIKey of (2S)-2-[(2,6-difluorophenyl)sulfonylamino]-3-methylbutanoic acid?
The InChIKey is PWJKNXONDMMVEM-VIFPVBQESA-N. The full InChI is InChI=1S/C11H13F2NO4S/c1-6(2)9(11(15)16)14-19(17,18)10-7(12)4-3-5-8(10)13/h3-6,9,14H,1-2H3,(H,15,16)/t9-/m0/s1.
What are the key properties of (2S)-2-[(2,6-difluorophenyl)sulfonylamino]-3-methylbutanoic acid?
(2S)-2-[(2,6-difluorophenyl)sulfonylamino]-3-methylbutanoic acid has a molecular weight of 293.29 g/mol, XLogP of 1.35, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[(2,6-difluorophenyl)sulfonylamino]-3-methylbutanoic acid is sourced from PubChem (CID 61136251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).