C14H19NO3S — CID 61137536
(2S,3S)-3-methyl-2-[(2-methylsulfanylbenzoyl)amino]pentanoic acid (PubChem CID 61137536) has the molecular formula C14H19NO3S and a molecular weight of 281.38 g/mol. Its IUPAC name is (2S,3S)-3-methyl-2-[(2-methylsulfanylbenzoyl)amino]pentanoic acid.
| Compound Name | (2S,3S)-3-methyl-2-[(2-methylsulfanylbenzoyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 61137536 |
| Molecular Formula | C14H19NO3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | (2S,3S)-3-methyl-2-[(2-methylsulfanylbenzoyl)amino]pentanoic acid |
| SMILES | CC[C@H](C)[C@H](NC(=O)c1ccccc1SC)C(=O)O |
| InChI | InChI=1S/C14H19NO3S/c1-4-9(2)12(14(17)18)15-13(16)10-7-5-6-8-11(10)19-3/h5-9,12H,4H2,1-3H3,(H,15,16)(H,17,18)/t9-,12-/m0/s1 |
| InChIKey | GMVAFIXGFDTAIW-CABZTGNLSA-N |
| XLogP | 2.64 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |