C25H26Cl4N2O2 — CID 6113775
(E)-3-(3,4-dichlorophenyl)-N-[7-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]heptyl]prop-2-enamide (PubChem CID 6113775) has the molecular formula C25H26Cl4N2O2 and a molecular weight of 528.31 g/mol. Its IUPAC name is (E)-3-(3,4-dichlorophenyl)-N-[7-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]heptyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dichlorophenyl)-N-[7-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]heptyl]prop-2-enamide |
|---|---|
| PubChem CID | 6113775 |
| Molecular Formula | C25H26Cl4N2O2 |
| Molecular Weight | 528.31 g/mol |
| Exact Mass | 526.07 |
| IUPAC Name | (E)-3-(3,4-dichlorophenyl)-N-[7-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]heptyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)c(Cl)c1)NCCCCCCCNC(=O)/C=C/c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C25H26Cl4N2O2/c26-20-10-6-18(16-22(20)28)8-12-24(32)30-14-4-2-1-3-5-15-31-25(33)13-9-19-7-11-21(27)23(29)17-19/h6-13,16-17H,1-5,14-15H2,(H,30,32)(H,31,33)/b12-8+,13-9+ |
| InChIKey | IHCYEHCZFUDJBS-QHKWOANTSA-N |
| XLogP | 7.21 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.31 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|