C12H19N5O2 — CID 61139010
4-(4-amino-1H-pyrrole-2-carbonyl)-N-ethylpiperazine-1-carboxamide (PubChem CID 61139010) has the molecular formula C12H19N5O2 and a molecular weight of 265.32 g/mol. Its IUPAC name is 4-(4-amino-1H-pyrrole-2-carbonyl)-N-ethylpiperazine-1-carboxamide.
| Compound Name | 4-(4-amino-1H-pyrrole-2-carbonyl)-N-ethylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 61139010 |
| Molecular Formula | C12H19N5O2 |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 4-(4-amino-1H-pyrrole-2-carbonyl)-N-ethylpiperazine-1-carboxamide |
| SMILES | CCNC(=O)N1CCN(C(=O)c2cc(N)c[nH]2)CC1 |
| InChI | InChI=1S/C12H19N5O2/c1-2-14-12(19)17-5-3-16(4-6-17)11(18)10-7-9(13)8-15-10/h7-8,15H,2-6,13H2,1H3,(H,14,19) |
| InChIKey | IGUBTEWCVHGUNB-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |