C13H19N3O3S — CID 61139917
2-[1-(2-aminophenyl)sulfonylpiperidin-4-yl]acetamide (PubChem CID 61139917) has the molecular formula C13H19N3O3S and a molecular weight of 297.38 g/mol. Its IUPAC name is 2-[1-(2-aminophenyl)sulfonylpiperidin-4-yl]acetamide.
| Compound Name | 2-[1-(2-aminophenyl)sulfonylpiperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 61139917 |
| Molecular Formula | C13H19N3O3S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 2-[1-(2-aminophenyl)sulfonylpiperidin-4-yl]acetamide |
| SMILES | NC(=O)CC1CCN(S(=O)(=O)c2ccccc2N)CC1 |
| InChI | InChI=1S/C13H19N3O3S/c14-11-3-1-2-4-12(11)20(18,19)16-7-5-10(6-8-16)9-13(15)17/h1-4,10H,5-9,14H2,(H2,15,17) |
| InChIKey | ROFHDCCCFMMFAX-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|