C12H17F3N2O3S — CID 61140479
5-amino-N-(2-hydroxyethyl)-2,3-dimethyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide (PubChem CID 61140479) has the molecular formula C12H17F3N2O3S and a molecular weight of 326.34 g/mol. Its IUPAC name is 5-amino-N-(2-hydroxyethyl)-2,3-dimethyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide.
| Compound Name | 5-amino-N-(2-hydroxyethyl)-2,3-dimethyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 61140479 |
| Molecular Formula | C12H17F3N2O3S |
| Molecular Weight | 326.34 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 5-amino-N-(2-hydroxyethyl)-2,3-dimethyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
| SMILES | Cc1cc(N)cc(S(=O)(=O)N(CCO)CC(F)(F)F)c1C |
| InChI | InChI=1S/C12H17F3N2O3S/c1-8-5-10(16)6-11(9(8)2)21(19,20)17(3-4-18)7-12(13,14)15/h5-6,18H,3-4,7,16H2,1-2H3 |
| InChIKey | ZXTDVSVOYITSEZ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.34 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|