C10H12BrF3N2O3S — CID 61140665
2-amino-4-bromo-N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)benzenesulfonamide (PubChem CID 61140665) has the molecular formula C10H12BrF3N2O3S and a molecular weight of 377.18 g/mol. Its IUPAC name is 2-amino-4-bromo-N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)benzenesulfonamide.
| Compound Name | 2-amino-4-bromo-N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 61140665 |
| Molecular Formula | C10H12BrF3N2O3S |
| Molecular Weight | 377.18 g/mol |
| Exact Mass | 375.97 |
| IUPAC Name | 2-amino-4-bromo-N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
| SMILES | Nc1cc(Br)ccc1S(=O)(=O)N(CCO)CC(F)(F)F |
| InChI | InChI=1S/C10H12BrF3N2O3S/c11-7-1-2-9(8(15)5-7)20(18,19)16(3-4-17)6-10(12,13)14/h1-2,5,17H,3-4,6,15H2 |
| InChIKey | ZASANJVMQMQBDE-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.18 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|