C11H15NO5S — CID 61141253
(2R)-2-amino-3-[(5-methoxycarbonyl-4-methylfuran-2-yl)methylsulfanyl]propanoic acid (PubChem CID 61141253) has the molecular formula C11H15NO5S and a molecular weight of 273.31 g/mol. Its IUPAC name is (2R)-2-amino-3-[(5-methoxycarbonyl-4-methylfuran-2-yl)methylsulfanyl]propanoic acid.
| Compound Name | (2R)-2-amino-3-[(5-methoxycarbonyl-4-methylfuran-2-yl)methylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 61141253 |
| Molecular Formula | C11H15NO5S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | (2R)-2-amino-3-[(5-methoxycarbonyl-4-methylfuran-2-yl)methylsulfanyl]propanoic acid |
| SMILES | COC(=O)c1oc(CSC[C@H](N)C(=O)O)cc1C |
| InChI | InChI=1S/C11H15NO5S/c1-6-3-7(17-9(6)11(15)16-2)4-18-5-8(12)10(13)14/h3,8H,4-5,12H2,1-2H3,(H,13,14)/t8-/m0/s1 |
| InChIKey | FVNYMAXSZUSEEN-QMMMGPOBSA-N |
| XLogP | 1.02 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |