C10H17NO4S2 — CID 61142378
(4R)-3-cyclohexylsulfonyl-1,3-thiazolidine-4-carboxylic acid (PubChem CID 61142378) has the molecular formula C10H17NO4S2 and a molecular weight of 279.38 g/mol. Its IUPAC name is (4R)-3-cyclohexylsulfonyl-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (4R)-3-cyclohexylsulfonyl-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 61142378 |
| Molecular Formula | C10H17NO4S2 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | (4R)-3-cyclohexylsulfonyl-1,3-thiazolidine-4-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CSCN1S(=O)(=O)C1CCCCC1 |
| InChI | InChI=1S/C10H17NO4S2/c12-10(13)9-6-16-7-11(9)17(14,15)8-4-2-1-3-5-8/h8-9H,1-7H2,(H,12,13)/t9-/m0/s1 |
| InChIKey | ZBIKXKAZXDMBFG-VIFPVBQESA-N |
| XLogP | 1.11 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |