About 1,4-dihydroxyfluoren-9-one
1,4-dihydroxyfluoren-9-one (PubChem CID 611427) has the molecular formula C13H8O3
and a molecular weight of 212.20 g/mol. Its IUPAC name is 1,4-dihydroxyfluoren-9-one.
Molecular Properties
| Compound Name | 1,4-dihydroxyfluoren-9-one |
| PubChem CID | 611427 |
| Molecular Formula | C13H8O3 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.05 |
| IUPAC Name | 1,4-dihydroxyfluoren-9-one |
| SMILES | O=C1c2ccccc2-c2c(O)ccc(O)c21 |
| InChI | InChI=1S/C13H8O3/c14-9-5-6-10(15)12-11(9)7-3-1-2-4-8(7)13(12)16/h1-6,14-15H |
| InChIKey | HVOYPCLFJHHOLC-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dihydroxyfluoren-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dihydroxyfluoren-9-one?
The IUPAC name of 1,4-dihydroxyfluoren-9-one (CID 611427) is 1,4-dihydroxyfluoren-9-one.
What is the SMILES notation for 1,4-dihydroxyfluoren-9-one?
The canonical SMILES for 1,4-dihydroxyfluoren-9-one is O=C1c2ccccc2-c2c(O)ccc(O)c21.
What is the InChIKey of 1,4-dihydroxyfluoren-9-one?
The InChIKey is HVOYPCLFJHHOLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8O3/c14-9-5-6-10(15)12-11(9)7-3-1-2-4-8(7)13(12)16/h1-6,14-15H.
What are the key properties of 1,4-dihydroxyfluoren-9-one?
1,4-dihydroxyfluoren-9-one has a molecular weight of 212.20 g/mol, XLogP of 2.31, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dihydroxyfluoren-9-one is sourced from PubChem (CID 611427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).