C24H21BrN4O3 — CID 6114291
2-(4-bromopyrazol-1-yl)-N-[(Z)-[3-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]acetamide (PubChem CID 6114291) has the molecular formula C24H21BrN4O3 and a molecular weight of 493.36 g/mol. Its IUPAC name is 2-(4-bromopyrazol-1-yl)-N-[(Z)-[3-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]acetamide.
| Compound Name | 2-(4-bromopyrazol-1-yl)-N-[(Z)-[3-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 6114291 |
| Molecular Formula | C24H21BrN4O3 |
| Molecular Weight | 493.36 g/mol |
| Exact Mass | 492.08 |
| IUPAC Name | 2-(4-bromopyrazol-1-yl)-N-[(Z)-[3-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]acetamide |
| SMILES | COc1cc(/C=N\NC(=O)Cn2cc(Br)cn2)ccc1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C24H21BrN4O3/c1-31-23-11-17(12-26-28-24(30)15-29-14-20(25)13-27-29)9-10-22(23)32-16-19-7-4-6-18-5-2-3-8-21(18)19/h2-14H,15-16H2,1H3,(H,28,30)/b26-12- |
| InChIKey | HIDSYNOVLZHMTL-ZRGSRPPYSA-N |
| XLogP | 4.54 |
| TPSA | 77.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.36 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|