C13H17ClN2O3 — CID 61143282
(2S)-2-[(3-chlorophenyl)carbamoylamino]-3,3-dimethylbutanoic acid (PubChem CID 61143282) has the molecular formula C13H17ClN2O3 and a molecular weight of 284.74 g/mol. Its IUPAC name is (2S)-2-[(3-chlorophenyl)carbamoylamino]-3,3-dimethylbutanoic acid.
| Compound Name | (2S)-2-[(3-chlorophenyl)carbamoylamino]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 61143282 |
| Molecular Formula | C13H17ClN2O3 |
| Molecular Weight | 284.74 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | (2S)-2-[(3-chlorophenyl)carbamoylamino]-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(C)[C@H](NC(=O)Nc1cccc(Cl)c1)C(=O)O |
| InChI | InChI=1S/C13H17ClN2O3/c1-13(2,3)10(11(17)18)16-12(19)15-9-6-4-5-8(14)7-9/h4-7,10H,1-3H3,(H,17,18)(H2,15,16,19)/t10-/m1/s1 |
| InChIKey | ZYOQKFUMILLVGD-SNVBAGLBSA-N |
| XLogP | 2.96 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.74 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |