C17H23NO3 — CID 61143505
(2S)-1-(2-ethylhexanoyl)-2,3-dihydroindole-2-carboxylic acid (PubChem CID 61143505) has the molecular formula C17H23NO3 and a molecular weight of 289.37 g/mol. Its IUPAC name is (2S)-1-(2-ethylhexanoyl)-2,3-dihydroindole-2-carboxylic acid.
| Compound Name | (2S)-1-(2-ethylhexanoyl)-2,3-dihydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 61143505 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | (2S)-1-(2-ethylhexanoyl)-2,3-dihydroindole-2-carboxylic acid |
| SMILES | CCCCC(CC)C(=O)N1c2ccccc2C[C@H]1C(=O)O |
| InChI | InChI=1S/C17H23NO3/c1-3-5-8-12(4-2)16(19)18-14-10-7-6-9-13(14)11-15(18)17(20)21/h6-7,9-10,12,15H,3-5,8,11H2,1-2H3,(H,20,21)/t12?,15-/m0/s1 |
| InChIKey | ATDCEGUOZFUZHF-CVRLYYSRSA-N |
| XLogP | 3.25 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |